* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW032601 |
English Synonyms: | ZERENEX ZXW032601 |
MDL Number.: | MFCD18471694 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCN(CC(=O)Nc1cc(ccc1OC)Cl)CC(=O)O |
InChi: | InChI=1S/C14H19ClN2O4/c1-3-6-17(9-14(19)20)8-13(18)16-11-7-10(15)4-5-12(11)21-2/h4-5,7H,3,6,8-9H2,1-2H3,(H,16,18)(H,19,20) |
InChiKey: | InChIKey=WDPSRWJQBRUZGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.