* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW037099 |
| English Synonyms: | ZERENEX ZXW037099 |
| MDL Number.: | MFCD18474003 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cnc(nc1)NC(=O)CN2CCCCC2CC(=O)O |
| InChi: | InChI=1S/C13H18N4O3/c18-11(16-13-14-5-3-6-15-13)9-17-7-2-1-4-10(17)8-12(19)20/h3,5-6,10H,1-2,4,7-9H2,(H,19,20)(H,14,15,16,18) |
| InChiKey: | InChIKey=BQVZGVHDESMKSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.