* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW037545 |
English Synonyms: | ZERENEX ZXW037545 |
MDL Number.: | MFCD18474212 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOc1ccccc1CNCC(C)N2CCCCC2 |
InChi: | InChI=1S/C17H28N2O/c1-3-20-17-10-6-5-9-16(17)14-18-13-15(2)19-11-7-4-8-12-19/h5-6,9-10,15,18H,3-4,7-8,11-14H2,1-2H3 |
InChiKey: | InChIKey=HUHIVAJLEFDTGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.