* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW038080 |
| English Synonyms: | ZERENEX ZXW038080 |
| MDL Number.: | MFCD18474484 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1cc(oc1C(=O)Nc2cnn(c2)CC(=O)O)[N+](=O)[O-] |
| InChi: | InChI=1S/C10H8N4O6/c15-9(16)5-13-4-6(3-11-13)12-10(17)7-1-2-8(20-7)14(18)19/h1-4H,5H2,(H,12,17)(H,15,16) |
| InChiKey: | InChIKey=HUBFNWRLQCUKNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.