* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW038095 |
English Synonyms: | ZERENEX ZXW038095 |
MDL Number.: | MFCD18474492 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c2c(sc1C(=O)Nc3cnn(c3)CC(=O)O)CCCC2 |
InChi: | InChI=1S/C14H15N3O3S/c18-13(19)8-17-7-10(6-15-17)16-14(20)12-5-9-3-1-2-4-11(9)21-12/h5-7H,1-4,8H2,(H,16,20)(H,18,19) |
InChiKey: | InChIKey=GWEDKISCUFFCSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.