* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW038111 |
| English Synonyms: | ZERENEX ZXW038111 |
| MDL Number.: | MFCD18474494 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COc1ccc(cc1)C(=O)Nc2cnn(c2)CC(=O)O |
| InChi: | InChI=1S/C13H13N3O4/c1-20-11-4-2-9(3-5-11)13(19)15-10-6-14-16(7-10)8-12(17)18/h2-7H,8H2,1H3,(H,15,19)(H,17,18) |
| InChiKey: | InChIKey=YJGONHNDHDGYFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.