* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW038461 |
| English Synonyms: | ZERENEX ZXW038461 |
| MDL Number.: | MFCD18474708 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)CC(S2)C(=O)Nc3cnn(c3)CC(=O)O |
| InChi: | InChI=1S/C14H13N3O3S/c18-13(19)8-17-7-10(6-15-17)16-14(20)12-5-9-3-1-2-4-11(9)21-12/h1-4,6-7,12H,5,8H2,(H,16,20)(H,18,19) |
| InChiKey: | InChIKey=KELABOQTKPKLBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.