* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW038488 |
English Synonyms: | ZERENEX ZXW038488 |
MDL Number.: | MFCD18474723 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | Cn1ccc(cc1=O)C(=O)Nc2cnn(c2)CC(=O)O |
InChi: | InChI=1S/C12H12N4O4/c1-15-3-2-8(4-10(15)17)12(20)14-9-5-13-16(6-9)7-11(18)19/h2-6H,7H2,1H3,(H,14,20)(H,18,19) |
InChiKey: | InChIKey=PVWQAZOXIWKWEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.