* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW038498 |
English Synonyms: | ZERENEX ZXW038498 |
MDL Number.: | MFCD18474732 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | COC(=O)Cn1cc(cn1)NC(=O)c2cc(on2)C3CC3 |
InChi: | InChI=1S/C13H14N4O4/c1-20-12(18)7-17-6-9(5-14-17)15-13(19)10-4-11(21-16-10)8-2-3-8/h4-6,8H,2-3,7H2,1H3,(H,15,19) |
InChiKey: | InChIKey=UZBIJNMIVWDPBL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.