* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW039652 |
English Synonyms: | ZERENEX ZXW039652 |
MDL Number.: | MFCD18475499 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CN(CC(=O)NCCCC(=O)O)CC(=O)N1CCNCC1 |
InChi: | InChI=1S/C13H24N4O4/c1-16(9-11(18)15-4-2-3-13(20)21)10-12(19)17-7-5-14-6-8-17/h14H,2-10H2,1H3,(H,15,18)(H,20,21) |
InChiKey: | InChIKey=MGJLCRGNPPMZSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.