* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW041229 |
English Synonyms: | ZERENEX ZXW041229 |
MDL Number.: | MFCD18476240 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CN(CCN)c2c3ccccc3cnn2 |
InChi: | InChI=1S/C17H18N4/c18-10-11-21(13-14-6-2-1-3-7-14)17-16-9-5-4-8-15(16)12-19-20-17/h1-9,12H,10-11,13,18H2 |
InChiKey: | InChIKey=BLZMHKDVHSOYBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.