* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW043409 |
English Synonyms: | ZERENEX ZXW043409 |
MDL Number.: | MFCD18477208 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CCCNC(=O)c1ccccc1Br)S(=O)(=O)C |
InChi: | InChI=1S/C13H19BrN2O3S/c1-3-16(20(2,18)19)10-6-9-15-13(17)11-7-4-5-8-12(11)14/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,15,17) |
InChiKey: | InChIKey=QWDVZHNBPUDZDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.