* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW043431 |
English Synonyms: | ZERENEX ZXW043431 |
MDL Number.: | MFCD18477225 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1CC(=O)NC(C2CCCCC2)C(=O)O)F |
InChi: | InChI=1S/C16H20FNO3/c17-13-8-6-11(7-9-13)10-14(19)18-15(16(20)21)12-4-2-1-3-5-12/h6-9,12,15H,1-5,10H2,(H,18,19)(H,20,21) |
InChiKey: | InChIKey=LZOYXWDFBVIYIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.