* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW043463 |
| English Synonyms: | ZERENEX ZXW043463 |
| MDL Number.: | MFCD18477246 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(c(cc1Cl)Cl)C(=O)NC(C2CCCCC2)C(=O)O |
| InChi: | InChI=1S/C15H17Cl2NO3/c16-10-6-7-11(12(17)8-10)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,19)(H,20,21) |
| InChiKey: | InChIKey=WWVFNVRTJNIFFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.