* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW047413 |
English Synonyms: | ZERENEX ZXW047413 |
MDL Number.: | MFCD18478481 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccccc1C(C)NCC(C)CN2CCCCC2 |
InChi: | InChI=1S/C18H30N2/c1-15(14-20-11-7-4-8-12-20)13-19-17(3)18-10-6-5-9-16(18)2/h5-6,9-10,15,17,19H,4,7-8,11-14H2,1-3H3 |
InChiKey: | InChIKey=CULGSRINXPTZGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.