* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW047420 |
English Synonyms: | ZERENEX ZXW047420 |
MDL Number.: | MFCD18478484 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(CCc1ccccc1)NCC(C)CN2CCCCC2 |
InChi: | InChI=1S/C19H32N2/c1-17(16-21-13-7-4-8-14-21)15-20-18(2)11-12-19-9-5-3-6-10-19/h3,5-6,9-10,17-18,20H,4,7-8,11-16H2,1-2H3 |
InChiKey: | InChIKey=GEGZBMDGOPSAPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.