* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW047436 |
| English Synonyms: | ZERENEX ZXW047436 |
| MDL Number.: | MFCD18478495 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(CNC(C)c1cccc(c1)OC)CN2CCCCC2 |
| InChi: | InChI=1S/C18H30N2O/c1-15(14-20-10-5-4-6-11-20)13-19-16(2)17-8-7-9-18(12-17)21-3/h7-9,12,15-16,19H,4-6,10-11,13-14H2,1-3H3 |
| InChiKey: | InChIKey=RYHHSFLXUVGPAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.