* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW048380 |
| English Synonyms: | ZERENEX ZXW048380 |
| MDL Number.: | MFCD18478980 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(c1ccccc1C(F)(F)F)NCC2CCCOC2 |
| InChi: | InChI=1S/C15H20F3NO/c1-11(19-9-12-5-4-8-20-10-12)13-6-2-3-7-14(13)15(16,17)18/h2-3,6-7,11-12,19H,4-5,8-10H2,1H3 |
| InChiKey: | InChIKey=CNIMGHLAIUSYGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.