* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW050400 |
English Synonyms: | ZERENEX ZXW050400 |
MDL Number.: | MFCD18479713 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCc1cccc(c1)OCC(CNCCCS(=O)(=O)C)O |
InChi: | InChI=1S/C15H25NO4S/c1-3-13-6-4-7-15(10-13)20-12-14(17)11-16-8-5-9-21(2,18)19/h4,6-7,10,14,16-17H,3,5,8-9,11-12H2,1-2H3 |
InChiKey: | InChIKey=VLWFKZPERBGNNS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.