* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW050568 |
English Synonyms: | ZERENEX ZXW050568 |
MDL Number.: | MFCD18479726 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1CNCCCS(=O)(=O)C)[N+](=O)[O-] |
InChi: | InChI=1S/C12H18N2O5S/c1-19-12-5-4-11(14(15)16)8-10(12)9-13-6-3-7-20(2,17)18/h4-5,8,13H,3,6-7,9H2,1-2H3 |
InChiKey: | InChIKey=FBILUAZJXAGGDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.