* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW051353 |
English Synonyms: | ZERENEX ZXW051353 |
MDL Number.: | MFCD18479950 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(c2cnccc2c1NC3CCCCC3N)[N+](=O)[O-] |
InChi: | InChI=1S/C15H18N4O2/c16-12-3-1-2-4-14(12)18-13-5-6-15(19(20)21)11-9-17-8-7-10(11)13/h5-9,12,14,18H,1-4,16H2 |
InChiKey: | InChIKey=VMUGVMKDACVUGR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.