* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW051435 |
English Synonyms: | ZERENEX ZXW051435 |
MDL Number.: | MFCD18479981 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)Cl)Cl)C(=O)N2CCSc3c2cc(cc3)N |
InChi: | InChI=1S/C15H12Cl2N2OS/c16-11-3-1-2-10(14(11)17)15(20)19-6-7-21-13-5-4-9(18)8-12(13)19/h1-5,8H,6-7,18H2 |
InChiKey: | InChIKey=GYXKIPNEYASZSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.