* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1101356 |
English Synonyms: | ZERENEX E/1101356 |
MDL Number.: | MFCD18480737 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC/C(=N\Nc1nc2cc(c(c(c2s1)C)NC(=O)c3ccc(cc3)c4ccccc4)C)/C |
InChi: | InChI=1S/C26H26N4OS/c1-5-17(3)29-30-26-27-22-15-16(2)23(18(4)24(22)32-26)28-25(31)21-13-11-20(12-14-21)19-9-7-6-8-10-19/h6-15H,5H2,1-4H3,(H,27,30)(H,28,31)/b29-17- |
InChiKey: | InChIKey=KOKAIYIALCHRET-RHANQZHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.