* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1101369 |
English Synonyms: | ZERENEX E/1101369 |
MDL Number.: | MFCD18480744 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCc1cc(cc(c1NC(=O)c2cc3ccccc3cc2OC)C)[N+](=O)[O-] |
InChi: | InChI=1S/C21H20N2O4/c1-4-14-10-17(23(25)26)9-13(2)20(14)22-21(24)18-11-15-7-5-6-8-16(15)12-19(18)27-3/h5-12H,4H2,1-3H3,(H,22,24) |
InChiKey: | InChIKey=QDDJHGMIFHYBPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.