* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1101856 |
English Synonyms: | ZERENEX E/1101856 |
MDL Number.: | MFCD18480968 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC/C(=N\Nc1nc2cc(c(c(c2s1)C)NC(=O)COc3c(cc(cc3Br)Br)C)C)/C |
InChi: | InChI=1S/C22H24Br2N4O2S/c1-6-13(4)27-28-22-25-17-8-11(2)19(14(5)21(17)31-22)26-18(29)10-30-20-12(3)7-15(23)9-16(20)24/h7-9H,6,10H2,1-5H3,(H,25,28)(H,26,29)/b27-13- |
InChiKey: | InChIKey=BFWZLVDJVJKPRI-WKIKZPBSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.