* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1101872 |
English Synonyms: | ZERENEX E/1101872 |
MDL Number.: | MFCD18480976 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1cc2c(c(c1NC(=O)COc3ccc(cc3)OC)C)sc(n2)n4c(cc(n4)C)C |
InChi: | InChI=1S/C23H24N4O3S/c1-13-10-19-22(31-23(24-19)27-15(3)11-14(2)26-27)16(4)21(13)25-20(28)12-30-18-8-6-17(29-5)7-9-18/h6-11H,12H2,1-5H3,(H,25,28) |
InChiKey: | InChIKey=OFLVRDAIBWYFGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.