* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102422 |
English Synonyms: | ZERENEX E/1102422 |
MDL Number.: | MFCD18481193 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1)C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N3CCCCC3C |
InChi: | InChI=1S/C20H22ClN3O3/c1-13-6-5-8-15(10-13)20(25)22-17-12-18(19(24(26)27)11-16(17)21)23-9-4-3-7-14(23)2/h5-6,8,10-12,14H,3-4,7,9H2,1-2H3,(H,22,25) |
InChiKey: | InChIKey=YTAKDJBPASBZOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.