Molecular Structure:
CCD No.:CCD04234334
ZERENEX E/1102431
Formula:C16 H16 Cl N3 O3
MolWeight:333.773
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1102431 |
| English Synonyms： | ZERENEX E/1102431 |
| MDL Number.： | MFCD18481202 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N(C)C |
| InChi： | InChI=1S/C16H16ClN3O3/c1-10-4-6-11(7-5-10)16(21)18-13-9-14(19(2)3)15(20(22)23)8-12(13)17/h4-9H,1-3H3,(H,18,21) |
| InChiKey： | InChIKey=FNOKBPYRZBTJLA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
