Molecular Structure:
CCD No.:CCD04234336
ZERENEX E/1102433
Formula:C17 H16 Cl N3 O3
MolWeight:345.784
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1102433 |
| English Synonyms： | ZERENEX E/1102433 |
| MDL Number.： | MFCD18481204 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N3CCCC3 |
| InChi： | InChI=1S/C17H16ClN3O3/c18-13-10-16(21(23)24)15(20-8-4-5-9-20)11-14(13)19-17(22)12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2,(H,19,22) |
| InChiKey： | InChIKey=FGGWZTJJMKWTCS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
