* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102436 |
English Synonyms: | ZERENEX E/1102436 |
MDL Number.: | MFCD18481207 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1ccccc1C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])NC3CCCCC3 |
InChi: | InChI=1S/C20H22ClN3O3/c1-13-7-5-6-10-15(13)20(25)23-17-12-18(19(24(26)27)11-16(17)21)22-14-8-3-2-4-9-14/h5-7,10-12,14,22H,2-4,8-9H2,1H3,(H,23,25) |
InChiKey: | InChIKey=BESGUJVXQCIFAB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.