* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102441 |
English Synonyms: | ZERENEX E/1102441 |
MDL Number.: | MFCD18481212 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)c1ccc(cc1)C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])NC3CCCCC3 |
InChi: | InChI=1S/C22H26ClN3O3/c1-14(2)15-8-10-16(11-9-15)22(27)25-19-13-20(21(26(28)29)12-18(19)23)24-17-6-4-3-5-7-17/h8-14,17,24H,3-7H2,1-2H3,(H,25,27) |
InChiKey: | InChIKey=MKEYHCHSTUIZOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.