* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102448 |
English Synonyms: | ZERENEX E/1102448 |
MDL Number.: | MFCD18481219 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCN(CC)c1cc(c(cc1[N+](=O)[O-])Cl)NC(=O)c2ccc(cc2)C(C)(C)C |
InChi: | InChI=1S/C21H26ClN3O3/c1-6-24(7-2)18-13-17(16(22)12-19(18)25(27)28)23-20(26)14-8-10-15(11-9-14)21(3,4)5/h8-13H,6-7H2,1-5H3,(H,23,26) |
InChiKey: | InChIKey=SZSZHAYUGMMFCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.