* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1102449 |
| English Synonyms: | ZERENEX E/1102449 |
| MDL Number.: | MFCD18481220 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)c1ccc(cc1)C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N3CCCC3 |
| InChi: | InChI=1S/C21H24ClN3O3/c1-21(2,3)15-8-6-14(7-9-15)20(26)23-17-13-18(24-10-4-5-11-24)19(25(27)28)12-16(17)22/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,23,26) |
| InChiKey: | InChIKey=VRYVTFHRDUQVIB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.