Molecular Structure:
CCD No.:CCD04234562
ZERENEX E/1102659
Formula:C17 H15 Cl F N3 O4
MolWeight:379.773
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1102659 |
| English Synonyms： | ZERENEX E/1102659 |
| MDL Number.： | MFCD18481430 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | c1cc(ccc1C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N3CCOCC3)F |
| InChi： | InChI=1S/C17H15ClFN3O4/c18-13-9-16(22(24)25)15(21-5-7-26-8-6-21)10-14(13)20-17(23)11-1-3-12(19)4-2-11/h1-4,9-10H,5-8H2,(H,20,23) |
| InChiKey： | InChIKey=KKPSFOWPNGFHSU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
