* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1102661 |
| English Synonyms: | ZERENEX E/1102661 |
| MDL Number.: | MFCD18481432 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | c1cc(c(cc1C(=O)Nc2cc(c(cc2Cl)[N+](=O)[O-])N3CCOCC3)Cl)Cl |
| InChi: | InChI=1S/C17H14Cl3N3O4/c18-11-2-1-10(7-12(11)19)17(24)21-14-9-15(22-3-5-27-6-4-22)16(23(25)26)8-13(14)20/h1-2,7-9H,3-6H2,(H,21,24) |
| InChiKey: | InChIKey=INSPAMDINGOVTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.