* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1102663 |
| English Synonyms: | ZERENEX E/1102663 |
| MDL Number.: | MFCD18481434 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CN1CCN(CC1)c2cc(c(cc2[N+](=O)[O-])Cl)NC(=O)c3cc(ccc3Cl)Cl |
| InChi: | InChI=1S/C18H17Cl3N4O3/c1-23-4-6-24(7-5-23)16-10-15(14(21)9-17(16)25(27)28)22-18(26)12-8-11(19)2-3-13(12)20/h2-3,8-10H,4-7H2,1H3,(H,22,26) |
| InChiKey: | InChIKey=YPBKKMFDTYKXMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.