* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102665 |
English Synonyms: | ZERENEX E/1102665 |
MDL Number.: | MFCD18481436 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCN1CCN(CC1)c2cc(c(cc2[N+](=O)[O-])Cl)NC(=O)c3ccc(cc3Cl)Cl |
InChi: | InChI=1S/C19H19Cl3N4O3/c1-2-24-5-7-25(8-6-24)17-11-16(15(22)10-18(17)26(28)29)23-19(27)13-4-3-12(20)9-14(13)21/h3-4,9-11H,2,5-8H2,1H3,(H,23,27) |
InChiKey: | InChIKey=BSHIILUSZWSHCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.