* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1102671 |
English Synonyms: | ZERENEX E/1102671 |
MDL Number.: | MFCD18481442 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1CCCCN1c2cc(c(cc2[N+](=O)[O-])Cl)NC(=O)c3ccc(c(c3)Cl)Cl |
InChi: | InChI=1S/C19H18Cl3N3O3/c1-11-4-2-3-7-24(11)17-10-16(15(22)9-18(17)25(27)28)23-19(26)12-5-6-13(20)14(21)8-12/h5-6,8-11H,2-4,7H2,1H3,(H,23,26) |
InChiKey: | InChIKey=GVPKGKSGUROQEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.