* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103132 |
English Synonyms: | ZERENEX E/1103132 |
MDL Number.: | MFCD18481665 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)CC(=O)Nc2ccc(cc2)NC(=S)N |
InChi: | InChI=1S/C15H15N3OS/c16-15(20)18-13-8-6-12(7-9-13)17-14(19)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,17,19)(H3,16,18,20) |
InChiKey: | InChIKey=DTOWKPDLDNZOLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.