Molecular Structure:
CCD No.:CCD04234799
ZERENEX E/1103135
Formula:C15 H14 N4 O S
MolWeight:298.369
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1103135 |
| English Synonyms： | ZERENEX E/1103135 |
| MDL Number.： | MFCD18481667 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1ccc(cc1)CC(=O)Nc2ccc3c(c2)sc(n3)NN |
| InChi： | InChI=1S/C15H14N4OS/c16-19-15-18-12-7-6-11(9-13(12)21-15)17-14(20)8-10-4-2-1-3-5-10/h1-7,9H,8,16H2,(H,17,20)(H,18,19) |
| InChiKey： | InChIKey=XCIVHWVFYABODZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
