Molecular Structure:
CCD No.:CCD04234802
ZERENEX E/1103138
Formula:C19 H20 N4 O S
MolWeight:352.46
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1103138 |
| English Synonyms： | ZERENEX E/1103138 |
| MDL Number.： | MFCD18481670 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CC/C(=N\Nc1nc2ccc(cc2s1)NC(=O)Cc3ccccc3)/C |
| InChi： | InChI=1S/C19H20N4OS/c1-3-13(2)22-23-19-21-16-10-9-15(12-17(16)25-19)20-18(24)11-14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,20,24)(H,21,23)/b22-13- |
| InChiKey： | InChIKey=CDNKXJJBPVWVDW-XKZIYDEJSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
