Molecular Structure:
CCD No.:CCD04234805
ZERENEX E/1103148
Formula:C10 H12 N4 O S
MolWeight:236.298
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1103148 |
| English Synonyms： | ZERENEX E/1103148 |
| MDL Number.： | MFCD18481673 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | CCC(=O)Nc1ccc2c(c1)sc(n2)NN |
| InChi： | InChI=1S/C10H12N4OS/c1-2-9(15)12-6-3-4-7-8(5-6)16-10(13-7)14-11/h3-5H,2,11H2,1H3,(H,12,15)(H,13,14) |
| InChiKey： | InChIKey=ZLYTWQYECZTEMG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
