* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103150 |
English Synonyms: | ZERENEX E/1103150 |
MDL Number.: | MFCD18481675 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCCC(=O)Nc1ccc2c(c1)sc(n2)NN |
InChi: | InChI=1S/C11H14N4OS/c1-2-3-10(16)13-7-4-5-8-9(6-7)17-11(14-8)15-12/h4-6H,2-3,12H2,1H3,(H,13,16)(H,14,15) |
InChiKey: | InChIKey=AAKZWDKMGIZFRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.