Molecular Structure:
CCD No.:CCD04234811
ZERENEX E/1103154
Formula:C15 H16 N4 O S
MolWeight:300.384
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1103154 |
| English Synonyms： | ZERENEX E/1103154 |
| MDL Number.： | MFCD18481679 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCC(=O)Nc1ccc2c(c1)sc(n2)n3c(cc(n3)C)C |
| InChi： | InChI=1S/C15H16N4OS/c1-4-14(20)16-11-5-6-12-13(8-11)21-15(17-12)19-10(3)7-9(2)18-19/h5-8H,4H2,1-3H3,(H,16,20) |
| InChiKey： | InChIKey=UJGIAWPDJZHPBY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
