* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103162 |
English Synonyms: | ZERENEX E/1103162 |
MDL Number.: | MFCD18481687 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCCC(=O)Nc1ccc2c(c1)sc(n2)N/N=C(/C)\CC |
InChi: | InChI=1S/C16H22N4OS/c1-4-6-7-15(21)17-12-8-9-13-14(10-12)22-16(18-13)20-19-11(3)5-2/h8-10H,4-7H2,1-3H3,(H,17,21)(H,18,20)/b19-11- |
InChiKey: | InChIKey=WGOCGKBNQRZXHF-ODLFYWEKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.