* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103164 |
English Synonyms: | ZERENEX E/1103164 |
MDL Number.: | MFCD18481689 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC/C(=N\Nc1nc2ccc(cc2s1)NC(=O)CC)/C |
InChi: | InChI=1S/C14H18N4OS/c1-4-9(3)17-18-14-16-11-7-6-10(8-12(11)20-14)15-13(19)5-2/h6-8H,4-5H2,1-3H3,(H,15,19)(H,16,18)/b17-9- |
InChiKey: | InChIKey=HDSCKIPBZHSGLD-MFOYZWKCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.