* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1103444 |
| English Synonyms: | ZERENEX E/1103444 |
| MDL Number.: | MFCD18481889 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC/C(=N\Nc1nc2c(ccc(c2s1)NC(=O)CC)Cl)/C |
| InChi: | InChI=1S/C14H17ClN4OS/c1-4-8(3)18-19-14-17-12-9(15)6-7-10(13(12)21-14)16-11(20)5-2/h6-7H,4-5H2,1-3H3,(H,16,20)(H,17,19)/b18-8- |
| InChiKey: | InChIKey=ZMXNPWZNDUELFR-LSCVHKIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.