Molecular Structure:
CCD No.:CCD04235038
ZERENEX E/1103566
Formula:C21 H18 Cl N O2
MolWeight:351.831
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1103566 |
| English Synonyms： | ZERENEX E/1103566 |
| MDL Number.： | MFCD18481906 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | Cc1cccc(c1)C(=O)Nc2ccc(cc2C(c3ccccc3)O)Cl |
| InChi： | InChI=1S/C21H18ClNO2/c1-14-6-5-9-16(12-14)21(25)23-19-11-10-17(22)13-18(19)20(24)15-7-3-2-4-8-15/h2-13,20,24H,1H3,(H,23,25) |
| InChiKey： | InChIKey=ILOKIPODSZOXSV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
