* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1103567 |
| English Synonyms: | ZERENEX E/1103567 |
| MDL Number.: | MFCD18481907 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)C(=O)Nc2ccc(cc2C(c3ccccc3)O)Cl |
| InChi: | InChI=1S/C21H18ClNO2/c1-14-7-9-16(10-8-14)21(25)23-19-12-11-17(22)13-18(19)20(24)15-5-3-2-4-6-15/h2-13,20,24H,1H3,(H,23,25) |
| InChiKey: | InChIKey=YQTKUSALRWBQOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.