* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103915 |
English Synonyms: | ZERENEX E/1103915 |
MDL Number.: | MFCD18482118 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC(C)c1ccc(cc1)C(=O)N2CCN(CC2)c3c(cccc3Cl)n4cnnc4 |
InChi: | InChI=1S/C22H24ClN5O/c1-16(2)17-6-8-18(9-7-17)22(29)27-12-10-26(11-13-27)21-19(23)4-3-5-20(21)28-14-24-25-15-28/h3-9,14-16H,10-13H2,1-2H3 |
InChiKey: | InChIKey=ROLXOXCMAQCWRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.